C27H35NO4Si — CID 11059672
(3aR,9S,9aR,9bS)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one (PubChem CID 11059672) has the molecular formula C27H35NO4Si and a molecular weight of 465.67 g/mol. Its IUPAC name is (3aR,9S,9aR,9bS)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one.
| Compound Name | (3aR,9S,9aR,9bS)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one |
|---|---|
| PubChem CID | 11059672 |
| Molecular Formula | C27H35NO4Si |
| Molecular Weight | 465.67 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | (3aR,9S,9aR,9bS)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one |
| SMILES | CC1(C)O[C@H]2[C@@H]3[C@@H](O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)CCC(=O)N3C[C@H]2O1 |
| InChI | InChI=1S/C27H35NO4Si/c1-26(2,3)33(19-12-8-6-9-13-19,20-14-10-7-11-15-20)32-21-16-17-23(29)28-18-22-25(24(21)28)31-27(4,5)30-22/h6-15,21-22,24-25H,16-18H2,1-5H3/t21-,22+,24-,25+/m0/s1 |
| InChIKey | ZDEAWFQGRGHJDV-TVYALGDOSA-N |
| XLogP | 3.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.67 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|