C28H37NO5Si — CID 102150863
(3aS,4S,9S,9aR,9bR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-9-hydroxy-2,2-dimethyl-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one (PubChem CID 102150863) has the molecular formula C28H37NO5Si and a molecular weight of 495.69 g/mol. Its IUPAC name is (3aS,4S,9S,9aR,9bR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-9-hydroxy-2,2-dimethyl-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one.
| Compound Name | (3aS,4S,9S,9aR,9bR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-9-hydroxy-2,2-dimethyl-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one |
|---|---|
| PubChem CID | 102150863 |
| Molecular Formula | C28H37NO5Si |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | (3aS,4S,9S,9aR,9bR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-9-hydroxy-2,2-dimethyl-4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizin-6-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1[C@@H](O)CCC(=O)N1[C@H]2CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H37NO5Si/c1-27(2,3)35(19-12-8-6-9-13-19,20-14-10-7-11-15-20)32-18-21-25-26(34-28(4,5)33-25)24-22(30)16-17-23(31)29(21)24/h6-15,21-22,24-26,30H,16-18H2,1-5H3/t21-,22-,24+,25-,26+/m0/s1 |
| InChIKey | ARUIOQDSKYUQAO-KRWKQCLOSA-N |
| XLogP | 2.82 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|