C25H33NO5Si — CID 10503962
(3S,6R,7R,8R,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,7,8-trihydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 10503962) has the molecular formula C25H33NO5Si and a molecular weight of 455.63 g/mol. Its IUPAC name is (3S,6R,7R,8R,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,7,8-trihydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (3S,6R,7R,8R,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,7,8-trihydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 10503962 |
| Molecular Formula | C25H33NO5Si |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | (3S,6R,7R,8R,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,7,8-trihydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@H]2[C@@H](O)[C@@H](O)[C@@H](O)C(=O)N12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H33NO5Si/c1-25(2,3)32(18-10-6-4-7-11-18,19-12-8-5-9-13-19)31-16-17-14-15-20-21(27)22(28)23(29)24(30)26(17)20/h4-13,17,20-23,27-29H,14-16H2,1-3H3/t17-,20-,21+,22+,23+/m0/s1 |
| InChIKey | KKELLSIECOEXKT-AZCFJWIISA-N |
| XLogP | 1.02 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|