C31H47NO3Si2 — CID 10650066
(3S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 10650066) has the molecular formula C31H47NO3Si2 and a molecular weight of 537.89 g/mol. Its IUPAC name is (3S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (3S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 10650066 |
| Molecular Formula | C31H47NO3Si2 |
| Molecular Weight | 537.89 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | (3S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC(=O)N2[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C31H47NO3Si2/c1-30(2,3)36(7,8)35-28-21-22-29(33)32-24(19-20-27(28)32)23-34-37(31(4,5)6,25-15-11-9-12-16-25)26-17-13-10-14-18-26/h9-18,24,27-28H,19-23H2,1-8H3/t24-,27-,28-/m0/s1 |
| InChIKey | CEQSXKCGMWRQGQ-WIRXVTQYSA-N |
| XLogP | 6.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.89 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|