C25H32N4O2Si — CID 11059395
(3S,6S,8aS)-6-azido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 11059395) has the molecular formula C25H32N4O2Si and a molecular weight of 448.64 g/mol. Its IUPAC name is (3S,6S,8aS)-6-azido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (3S,6S,8aS)-6-azido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 11059395 |
| Molecular Formula | C25H32N4O2Si |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (3S,6S,8aS)-6-azido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@H]2CC[C@H](N=[N+]=[N-])C(=O)N21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H32N4O2Si/c1-25(2,3)32(21-10-6-4-7-11-21,22-12-8-5-9-13-22)31-18-20-15-14-19-16-17-23(27-28-26)24(30)29(19)20/h4-13,19-20,23H,14-18H2,1-3H3/t19-,20-,23-/m0/s1 |
| InChIKey | ICCMDHVDDWUBPM-JTAQYXEDSA-N |
| XLogP | 4.40 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|