C32H38N4O2Si — CID 11734226
(3S,6R,8aS)-6-azido-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,7,8,8a-hexahydroindolizin-5-one (PubChem CID 11734226) has the molecular formula C32H38N4O2Si and a molecular weight of 538.77 g/mol. Its IUPAC name is (3S,6R,8aS)-6-azido-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,7,8,8a-hexahydroindolizin-5-one.
| Compound Name | (3S,6R,8aS)-6-azido-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,7,8,8a-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 11734226 |
| Molecular Formula | C32H38N4O2Si |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | (3S,6R,8aS)-6-azido-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,7,8,8a-hexahydroindolizin-5-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@H]2CC[C@](Cc3ccccc3)(N=[N+]=[N-])C(=O)N21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H38N4O2Si/c1-31(2,3)39(28-15-9-5-10-16-28,29-17-11-6-12-18-29)38-24-27-20-19-26-21-22-32(34-35-33,30(37)36(26)27)23-25-13-7-4-8-14-25/h4-18,26-27H,19-24H2,1-3H3/t26-,27-,32+/m0/s1 |
| InChIKey | LWDSXXVILCRYSW-KWHBQZNLSA-N |
| XLogP | 6.01 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|