C32H49NO3Si2 — CID 100970003
(3S,8S,8aS)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 100970003) has the molecular formula C32H49NO3Si2 and a molecular weight of 551.92 g/mol. Its IUPAC name is (3S,8S,8aS)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (3S,8S,8aS)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 100970003 |
| Molecular Formula | C32H49NO3Si2 |
| Molecular Weight | 551.92 g/mol |
| Exact Mass | 551.33 |
| IUPAC Name | (3S,8S,8aS)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CCC(=O)N2[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C32H49NO3Si2/c1-31(2,3)37(7,8)35-23-25-19-22-30(34)33-26(20-21-29(25)33)24-36-38(32(4,5)6,27-15-11-9-12-16-27)28-17-13-10-14-18-28/h9-18,25-26,29H,19-24H2,1-8H3/t25-,26+,29+/m1/s1 |
| InChIKey | CNKQLQADMHRGTA-ALTZYDRJSA-N |
| XLogP | 6.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.92 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|