C21H25NO2Si — CID 11068140
(1R,8aS)-1-[methyl(diphenyl)silyl]oxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 11068140) has the molecular formula C21H25NO2Si and a molecular weight of 351.52 g/mol. Its IUPAC name is (1R,8aS)-1-[methyl(diphenyl)silyl]oxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (1R,8aS)-1-[methyl(diphenyl)silyl]oxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 11068140 |
| Molecular Formula | C21H25NO2Si |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (1R,8aS)-1-[methyl(diphenyl)silyl]oxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | C[Si](O[C@@H]1CCN2C(=O)CCC[C@@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO2Si/c1-25(17-9-4-2-5-10-17,18-11-6-3-7-12-18)24-20-15-16-22-19(20)13-8-14-21(22)23/h2-7,9-12,19-20H,8,13-16H2,1H3/t19-,20+/m0/s1 |
| InChIKey | HOPPCBBKPLWGMC-VQTJNVASSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|