C20H30ClNO2SeSi — CID 11015967
(2R,6R,8R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-6-chloro-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 11015967) has the molecular formula C20H30ClNO2SeSi and a molecular weight of 458.96 g/mol. Its IUPAC name is (2R,6R,8R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-6-chloro-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (2R,6R,8R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-6-chloro-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 11015967 |
| Molecular Formula | C20H30ClNO2SeSi |
| Molecular Weight | 458.96 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | (2R,6R,8R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-6-chloro-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H]2[C@H]([Se]c3ccccc3)C[C@@H](Cl)C(=O)N2C1 |
| InChI | InChI=1S/C20H30ClNO2SeSi/c1-20(2,3)26(4,5)24-14-11-17-18(25-15-9-7-6-8-10-15)12-16(21)19(23)22(17)13-14/h6-10,14,16-18H,11-13H2,1-5H3/t14-,16-,17+,18-/m1/s1 |
| InChIKey | KGYMNWVRNJIVIS-NRSFXHEJSA-N |
| XLogP | 3.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.96 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|