C19H27NO3Si — CID 69123371
(6R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2-phenyl-5,6,7,8-tetrahydropyrrolizin-3-one (PubChem CID 69123371) has the molecular formula C19H27NO3Si and a molecular weight of 345.51 g/mol. Its IUPAC name is (6R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2-phenyl-5,6,7,8-tetrahydropyrrolizin-3-one.
| Compound Name | (6R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2-phenyl-5,6,7,8-tetrahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 69123371 |
| Molecular Formula | C19H27NO3Si |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (6R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-2-phenyl-5,6,7,8-tetrahydropyrrolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2C(O)=C(c3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C19H27NO3Si/c1-19(2,3)24(4,5)23-14-11-15-17(21)16(18(22)20(15)12-14)13-9-7-6-8-10-13/h6-10,14-15,21H,11-12H2,1-5H3/t14-,15-/m1/s1 |
| InChIKey | FLHBIRMHZGQPNT-HUUCEWRRSA-N |
| XLogP | 3.96 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|