C15H27ClINO3Si — CID 50936836
(2R,6R,7R,8S,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-6-chloro-8-iodo-7-methoxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 50936836) has the molecular formula C15H27ClINO3Si and a molecular weight of 459.83 g/mol. Its IUPAC name is (2R,6R,7R,8S,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-6-chloro-8-iodo-7-methoxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (2R,6R,7R,8S,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-6-chloro-8-iodo-7-methoxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 50936836 |
| Molecular Formula | C15H27ClINO3Si |
| Molecular Weight | 459.83 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | (2R,6R,7R,8S,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-6-chloro-8-iodo-7-methoxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CO[C@H]1[C@@H](I)[C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)CN2C(=O)[C@@H]1Cl |
| InChI | InChI=1S/C15H27ClINO3Si/c1-15(2,3)22(5,6)21-9-7-10-12(17)13(20-4)11(16)14(19)18(10)8-9/h9-13H,7-8H2,1-6H3/t9-,10+,11-,12+,13-/m1/s1 |
| InChIKey | SDFPFECXNNTCRE-RXGFPQBGSA-N |
| XLogP | 3.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|