C14H24BrNO3Si — CID 151439336
(1R,6R,8S)-1-(bromomethyl)-6-[tert-butyl(dimethyl)silyl]oxy-5,6,7,8-tetrahydro-1H-pyrrolizine-2,3-dione (PubChem CID 151439336) has the molecular formula C14H24BrNO3Si and a molecular weight of 362.34 g/mol. Its IUPAC name is (1R,6R,8S)-1-(bromomethyl)-6-[tert-butyl(dimethyl)silyl]oxy-5,6,7,8-tetrahydro-1H-pyrrolizine-2,3-dione.
| Compound Name | (1R,6R,8S)-1-(bromomethyl)-6-[tert-butyl(dimethyl)silyl]oxy-5,6,7,8-tetrahydro-1H-pyrrolizine-2,3-dione |
|---|---|
| PubChem CID | 151439336 |
| Molecular Formula | C14H24BrNO3Si |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | (1R,6R,8S)-1-(bromomethyl)-6-[tert-butyl(dimethyl)silyl]oxy-5,6,7,8-tetrahydro-1H-pyrrolizine-2,3-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H]2[C@@H](CBr)C(=O)C(=O)N2C1 |
| InChI | InChI=1S/C14H24BrNO3Si/c1-14(2,3)20(4,5)19-9-6-11-10(7-15)12(17)13(18)16(11)8-9/h9-11H,6-8H2,1-5H3/t9-,10-,11+/m1/s1 |
| InChIKey | PEEQMJMICLTKDS-MXWKQRLJSA-N |
| XLogP | 2.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|