C14H27NO3Si — CID 11828374
(2S,3R,3aS,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carbaldehyde (PubChem CID 11828374) has the molecular formula C14H27NO3Si and a molecular weight of 285.46 g/mol. Its IUPAC name is (2S,3R,3aS,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carbaldehyde.
| Compound Name | (2S,3R,3aS,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 11828374 |
| Molecular Formula | C14H27NO3Si |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | (2S,3R,3aS,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carbaldehyde |
| SMILES | C[C@@H]1ON2C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]2[C@H]1C=O |
| InChI | InChI=1S/C14H27NO3Si/c1-10-12(9-16)13-7-11(8-15(13)17-10)18-19(5,6)14(2,3)4/h9-13H,7-8H2,1-6H3/t10-,11+,12-,13-/m0/s1 |
| InChIKey | DWVOPGPKSJONLQ-RNJOBUHISA-N |
| XLogP | 2.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|