C24H29NO3Si — CID 167627291
(1S,8aS)-1-[tert-butyl(diphenyl)silyl]oxy-1,2,3,6,7,8a-hexahydroindolizine-5,8-dione (PubChem CID 167627291) has the molecular formula C24H29NO3Si and a molecular weight of 407.59 g/mol. Its IUPAC name is (1S,8aS)-1-[tert-butyl(diphenyl)silyl]oxy-1,2,3,6,7,8a-hexahydroindolizine-5,8-dione.
| Compound Name | (1S,8aS)-1-[tert-butyl(diphenyl)silyl]oxy-1,2,3,6,7,8a-hexahydroindolizine-5,8-dione |
|---|---|
| PubChem CID | 167627291 |
| Molecular Formula | C24H29NO3Si |
| Molecular Weight | 407.59 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (1S,8aS)-1-[tert-butyl(diphenyl)silyl]oxy-1,2,3,6,7,8a-hexahydroindolizine-5,8-dione |
| SMILES | CC(C)(C)[Si](O[C@H]1CCN2C(=O)CCC(=O)[C@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29NO3Si/c1-24(2,3)29(18-10-6-4-7-11-18,19-12-8-5-9-13-19)28-21-16-17-25-22(27)15-14-20(26)23(21)25/h4-13,21,23H,14-17H2,1-3H3/t21-,23+/m0/s1 |
| InChIKey | NHFJFILCDUEZIH-JTHBVZDNSA-N |
| XLogP | 2.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|