C25H31NO3Si — CID 71546109
(3S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,6,7,8a-hexahydroindolizine-5,8-dione (PubChem CID 71546109) has the molecular formula C25H31NO3Si and a molecular weight of 421.61 g/mol. Its IUPAC name is (3S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,6,7,8a-hexahydroindolizine-5,8-dione.
| Compound Name | (3S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,6,7,8a-hexahydroindolizine-5,8-dione |
|---|---|
| PubChem CID | 71546109 |
| Molecular Formula | C25H31NO3Si |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | (3S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,6,7,8a-hexahydroindolizine-5,8-dione |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@H]2C(=O)CCC(=O)N12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31NO3Si/c1-25(2,3)30(20-10-6-4-7-11-20,21-12-8-5-9-13-21)29-18-19-14-15-22-23(27)16-17-24(28)26(19)22/h4-13,19,22H,14-18H2,1-3H3/t19-,22-/m0/s1 |
| InChIKey | CUBGXSDPEVIIDR-UGKGYDQZSA-N |
| XLogP | 3.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|