C25H31NO3Si — CID 11048098
(1aS,5S,7aS,7bR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5,6,7,7a,7b-hexahydro-1aH-oxireno[2,3-g]indolizin-3-one (PubChem CID 11048098) has the molecular formula C25H31NO3Si and a molecular weight of 421.61 g/mol. Its IUPAC name is (1aS,5S,7aS,7bR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5,6,7,7a,7b-hexahydro-1aH-oxireno[2,3-g]indolizin-3-one.
| Compound Name | (1aS,5S,7aS,7bR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5,6,7,7a,7b-hexahydro-1aH-oxireno[2,3-g]indolizin-3-one |
|---|---|
| PubChem CID | 11048098 |
| Molecular Formula | C25H31NO3Si |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | (1aS,5S,7aS,7bR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5,6,7,7a,7b-hexahydro-1aH-oxireno[2,3-g]indolizin-3-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@H]2[C@H]3O[C@H]3CC(=O)N12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31NO3Si/c1-25(2,3)30(19-10-6-4-7-11-19,20-12-8-5-9-13-20)28-17-18-14-15-21-24-22(29-24)16-23(27)26(18)21/h4-13,18,21-22,24H,14-17H2,1-3H3/t18-,21-,22-,24+/m0/s1 |
| InChIKey | IMYQCENGOBZJAS-GDXZIDHASA-N |
| XLogP | 3.09 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|