C27H36N4O3Si — CID 11409274
(3S,6S,8S,8aS)-6-azido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methoxy-6-methyl-1,2,3,7,8,8a-hexahydroindolizin-5-one (PubChem CID 11409274) has the molecular formula C27H36N4O3Si and a molecular weight of 492.70 g/mol. Its IUPAC name is (3S,6S,8S,8aS)-6-azido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methoxy-6-methyl-1,2,3,7,8,8a-hexahydroindolizin-5-one.
| Compound Name | (3S,6S,8S,8aS)-6-azido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methoxy-6-methyl-1,2,3,7,8,8a-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 11409274 |
| Molecular Formula | C27H36N4O3Si |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | (3S,6S,8S,8aS)-6-azido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methoxy-6-methyl-1,2,3,7,8,8a-hexahydroindolizin-5-one |
| SMILES | CO[C@H]1C[C@](C)(N=[N+]=[N-])C(=O)N2[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C27H36N4O3Si/c1-26(2,3)35(21-12-8-6-9-13-21,22-14-10-7-11-15-22)34-19-20-16-17-23-24(33-5)18-27(4,29-30-28)25(32)31(20)23/h6-15,20,23-24H,16-19H2,1-5H3/t20-,23-,24-,27-/m0/s1 |
| InChIKey | RAIVSGRLWACEDL-GGHZGINBSA-N |
| XLogP | 4.41 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|