C28H35NO4Si — CID 71546111
(3S,8R,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]spiro[1,2,3,6,7,8a-hexahydroindolizine-8,5'-oxolane]-2',5-dione (PubChem CID 71546111) has the molecular formula C28H35NO4Si and a molecular weight of 477.68 g/mol. Its IUPAC name is (3S,8R,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]spiro[1,2,3,6,7,8a-hexahydroindolizine-8,5'-oxolane]-2',5-dione.
| Compound Name | (3S,8R,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]spiro[1,2,3,6,7,8a-hexahydroindolizine-8,5'-oxolane]-2',5-dione |
|---|---|
| PubChem CID | 71546111 |
| Molecular Formula | C28H35NO4Si |
| Molecular Weight | 477.68 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | (3S,8R,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]spiro[1,2,3,6,7,8a-hexahydroindolizine-8,5'-oxolane]-2',5-dione |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@@H]2N1C(=O)CC[C@@]21CCC(=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H35NO4Si/c1-27(2,3)34(22-10-6-4-7-11-22,23-12-8-5-9-13-23)32-20-21-14-15-24-28(19-17-26(31)33-28)18-16-25(30)29(21)24/h4-13,21,24H,14-20H2,1-3H3/t21-,24-,28+/m0/s1 |
| InChIKey | GZAWVQDHAXMJBW-YGZVCBRSSA-N |
| XLogP | 3.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.68 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|