C30H41NO5Si — CID 10839786
tert-butyl (2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2R)-5-oxooxolan-2-yl]pyrrolidine-1-carboxylate (PubChem CID 10839786) has the molecular formula C30H41NO5Si and a molecular weight of 523.75 g/mol. Its IUPAC name is tert-butyl (2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2R)-5-oxooxolan-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2R)-5-oxooxolan-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10839786 |
| Molecular Formula | C30H41NO5Si |
| Molecular Weight | 523.75 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | tert-butyl (2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2R)-5-oxooxolan-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[C@@H]1[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C30H41NO5Si/c1-29(2,3)36-28(33)31-22(17-18-25(31)26-19-20-27(32)35-26)21-34-37(30(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,22,25-26H,17-21H2,1-6H3/t22-,25-,26-/m1/s1 |
| InChIKey | UVXOEBWXAVOCOS-DNRSQYFGSA-N |
| XLogP | 5.04 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.75 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|