C34H47NO5Si — CID 11813872
tert-butyl (2S)-2-[(2S,4Z)-4-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropylidene]-2-methyl-5-oxooxolan-2-yl]pyrrolidine-1-carboxylate (PubChem CID 11813872) has the molecular formula C34H47NO5Si and a molecular weight of 577.84 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2S,4Z)-4-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropylidene]-2-methyl-5-oxooxolan-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(2S,4Z)-4-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropylidene]-2-methyl-5-oxooxolan-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11813872 |
| Molecular Formula | C34H47NO5Si |
| Molecular Weight | 577.84 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | tert-butyl (2S)-2-[(2S,4Z)-4-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropylidene]-2-methyl-5-oxooxolan-2-yl]pyrrolidine-1-carboxylate |
| SMILES | C[C@@H](/C=C1/C[C@@](C)([C@@H]2CCCN2C(=O)OC(C)(C)C)OC1=O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H47NO5Si/c1-25(24-38-41(33(5,6)7,27-16-11-9-12-17-27)28-18-13-10-14-19-28)22-26-23-34(8,39-30(26)36)29-20-15-21-35(29)31(37)40-32(2,3)4/h9-14,16-19,22,25,29H,15,20-21,23-24H2,1-8H3/b26-22-/t25-,29-,34-/m0/s1 |
| InChIKey | VPMBKGCWBPFUFP-DWVSKQGVSA-N |
| XLogP | 6.23 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.84 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|