C37H49NO5Si — CID 178107601
tert-butyl (2S)-2-[(1R)-1-benzoyloxyethyl]-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolidine-1-carboxylate (PubChem CID 178107601) has the molecular formula C37H49NO5Si and a molecular weight of 615.89 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1R)-1-benzoyloxyethyl]-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(1R)-1-benzoyloxyethyl]-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 178107601 |
| Molecular Formula | C37H49NO5Si |
| Molecular Weight | 615.89 g/mol |
| Exact Mass | 615.34 |
| IUPAC Name | tert-butyl (2S)-2-[(1R)-1-benzoyloxyethyl]-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@@H](OC(=O)c1ccccc1)[C@@H]1CCC(CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H49NO5Si/c1-28(42-34(39)29-18-11-8-12-19-29)33-26-25-30(38(33)35(40)43-36(2,3)4)20-17-27-41-44(37(5,6)7,31-21-13-9-14-22-31)32-23-15-10-16-24-32/h8-16,18-19,21-24,28,30,33H,17,20,25-27H2,1-7H3/t28-,30?,33+/m1/s1 |
| InChIKey | YODKFFHKMXFBGG-IDGKNORKSA-N |
| XLogP | 7.36 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.89 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|