C25H25NO7 — CID 11026765
[(1S,2R)-2-benzoyloxy-3-[2-(4-hydroxy-2-oxo-1,3-oxazolidin-3-yl)ethyl]cyclohex-3-en-1-yl] benzoate (PubChem CID 11026765) has the molecular formula C25H25NO7 and a molecular weight of 451.48 g/mol. Its IUPAC name is [(1S,2R)-2-benzoyloxy-3-[2-(4-hydroxy-2-oxo-1,3-oxazolidin-3-yl)ethyl]cyclohex-3-en-1-yl] benzoate.
| Compound Name | [(1S,2R)-2-benzoyloxy-3-[2-(4-hydroxy-2-oxo-1,3-oxazolidin-3-yl)ethyl]cyclohex-3-en-1-yl] benzoate |
|---|---|
| PubChem CID | 11026765 |
| Molecular Formula | C25H25NO7 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | [(1S,2R)-2-benzoyloxy-3-[2-(4-hydroxy-2-oxo-1,3-oxazolidin-3-yl)ethyl]cyclohex-3-en-1-yl] benzoate |
| SMILES | O=C(O[C@H]1CCC=C(CCN2C(=O)OCC2O)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO7/c27-21-16-31-25(30)26(21)15-14-17-12-7-13-20(32-23(28)18-8-3-1-4-9-18)22(17)33-24(29)19-10-5-2-6-11-19/h1-6,8-12,20-22,27H,7,13-16H2/t20-,21?,22+/m0/s1 |
| InChIKey | FOWLFDYVHTVZLW-JAFNVKOHSA-N |
| XLogP | 3.32 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|