C33H39NO6Si — CID 11376588
tert-butyl (2R,4S)-4-benzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxopyrrolidine-1-carboxylate (PubChem CID 11376588) has the molecular formula C33H39NO6Si and a molecular weight of 573.76 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-benzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-4-benzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11376588 |
| Molecular Formula | C33H39NO6Si |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | tert-butyl (2R,4S)-4-benzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](OC(=O)c2ccccc2)C(=O)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H39NO6Si/c1-32(2,3)40-31(37)34-22-28(39-30(36)24-16-10-7-11-17-24)29(35)27(34)23-38-41(33(4,5)6,25-18-12-8-13-19-25)26-20-14-9-15-21-26/h7-21,27-28H,22-23H2,1-6H3/t27-,28+/m1/s1 |
| InChIKey | ARPKEJLVPQKLLM-IZLXSDGUSA-N |
| XLogP | 4.98 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|