C34H51NO6Si2 — CID 146164267
benzyl (2R,3R,4R,5R)-4-benzoyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenylpyrrolidine-1-carboxylate (PubChem CID 146164267) has the molecular formula C34H51NO6Si2 and a molecular weight of 625.96 g/mol. Its IUPAC name is benzyl (2R,3R,4R,5R)-4-benzoyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3R,4R,5R)-4-benzoyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146164267 |
| Molecular Formula | C34H51NO6Si2 |
| Molecular Weight | 625.96 g/mol |
| Exact Mass | 625.33 |
| IUPAC Name | benzyl (2R,3R,4R,5R)-4-benzoyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenylpyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]1[C@@H](OC(=O)c2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H51NO6Si2/c1-12-27-29(40-31(36)26-21-17-14-18-22-26)30(41-43(10,11)34(5,6)7)28(24-39-42(8,9)33(2,3)4)35(27)32(37)38-23-25-19-15-13-16-20-25/h12-22,27-30H,1,23-24H2,2-11H3/t27-,28-,29-,30-/m1/s1 |
| InChIKey | CTXYOTKQRJNTJT-SKKKGAJSSA-N |
| XLogP | 8.20 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.96 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|