C28H39FN2O4Si — CID 90059592
[(2R,3R,4R,5R)-5-(acetamidomethyl)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-4-fluoropyrrolidin-2-yl]methyl benzoate (PubChem CID 90059592) has the molecular formula C28H39FN2O4Si and a molecular weight of 514.71 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(acetamidomethyl)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-4-fluoropyrrolidin-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-5-(acetamidomethyl)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-4-fluoropyrrolidin-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 90059592 |
| Molecular Formula | C28H39FN2O4Si |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(acetamidomethyl)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-4-fluoropyrrolidin-2-yl]methyl benzoate |
| SMILES | CC(=O)NC[C@@H]1[C@@H](F)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COC(=O)c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H39FN2O4Si/c1-20(32)30-17-23-25(29)26(35-36(5,6)28(2,3)4)24(31(23)18-21-13-9-7-10-14-21)19-34-27(33)22-15-11-8-12-16-22/h7-16,23-26H,17-19H2,1-6H3,(H,30,32)/t23-,24-,25-,26-/m1/s1 |
| InChIKey | CBUBCCWPBJBXHE-VEYUFSJPSA-N |
| XLogP | 4.96 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|