C24H39NO5Si — CID 11546863
tert-butyl (2R,3R)-2-(benzoyloxymethyl)-3-methyl-3-triethylsilyloxypyrrolidine-1-carboxylate (PubChem CID 11546863) has the molecular formula C24H39NO5Si and a molecular weight of 449.66 g/mol. Its IUPAC name is tert-butyl (2R,3R)-2-(benzoyloxymethyl)-3-methyl-3-triethylsilyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-2-(benzoyloxymethyl)-3-methyl-3-triethylsilyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11546863 |
| Molecular Formula | C24H39NO5Si |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | tert-butyl (2R,3R)-2-(benzoyloxymethyl)-3-methyl-3-triethylsilyloxypyrrolidine-1-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)CCN(C(=O)OC(C)(C)C)[C@@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H39NO5Si/c1-8-31(9-2,10-3)30-24(7)16-17-25(22(27)29-23(4,5)6)20(24)18-28-21(26)19-14-12-11-13-15-19/h11-15,20H,8-10,16-18H2,1-7H3/t20-,24-/m1/s1 |
| InChIKey | JZTZKKAWVMZIMQ-HYBUGGRVSA-N |
| XLogP | 5.63 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|