C32H34NO5P — CID 100993117
[(3R,4S)-2,4-dimethyl-5-oxo-5-[(4R)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]pent-1-en-3-yl] 2-diphenylphosphanylbenzoate (PubChem CID 100993117) has the molecular formula C32H34NO5P and a molecular weight of 543.60 g/mol. Its IUPAC name is [(3R,4S)-2,4-dimethyl-5-oxo-5-[(4R)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]pent-1-en-3-yl] 2-diphenylphosphanylbenzoate.
| Compound Name | [(3R,4S)-2,4-dimethyl-5-oxo-5-[(4R)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]pent-1-en-3-yl] 2-diphenylphosphanylbenzoate |
|---|---|
| PubChem CID | 100993117 |
| Molecular Formula | C32H34NO5P |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | [(3R,4S)-2,4-dimethyl-5-oxo-5-[(4R)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]pent-1-en-3-yl] 2-diphenylphosphanylbenzoate |
| SMILES | C=C(C)[C@H](OC(=O)c1ccccc1P(c1ccccc1)c1ccccc1)[C@H](C)C(=O)N1C(=O)OC[C@H]1C(C)C |
| InChI | InChI=1S/C32H34NO5P/c1-21(2)27-20-37-32(36)33(27)30(34)23(5)29(22(3)4)38-31(35)26-18-12-13-19-28(26)39(24-14-8-6-9-15-24)25-16-10-7-11-17-25/h6-19,21,23,27,29H,3,20H2,1-2,4-5H3/t23-,27-,29-/m0/s1 |
| InChIKey | QLEJUQBVPIGWID-HTZJHERLSA-N |
| XLogP | 5.19 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|