C33H36NO6P — CID 10995410
[(2S,3S,4R)-2,4-dimethyl-1,6-dioxo-1-[(4R)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]hexan-3-yl] 2-diphenylphosphanylbenzoate (PubChem CID 10995410) has the molecular formula C33H36NO6P and a molecular weight of 573.63 g/mol. Its IUPAC name is [(2S,3S,4R)-2,4-dimethyl-1,6-dioxo-1-[(4R)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]hexan-3-yl] 2-diphenylphosphanylbenzoate.
| Compound Name | [(2S,3S,4R)-2,4-dimethyl-1,6-dioxo-1-[(4R)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]hexan-3-yl] 2-diphenylphosphanylbenzoate |
|---|---|
| PubChem CID | 10995410 |
| Molecular Formula | C33H36NO6P |
| Molecular Weight | 573.63 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | [(2S,3S,4R)-2,4-dimethyl-1,6-dioxo-1-[(4R)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]hexan-3-yl] 2-diphenylphosphanylbenzoate |
| SMILES | CC(C)[C@@H]1COC(=O)N1C(=O)[C@@H](C)[C@@H](OC(=O)c1ccccc1P(c1ccccc1)c1ccccc1)[C@H](C)CC=O |
| InChI | InChI=1S/C33H36NO6P/c1-22(2)28-21-39-33(38)34(28)31(36)24(4)30(23(3)19-20-35)40-32(37)27-17-11-12-18-29(27)41(25-13-7-5-8-14-25)26-15-9-6-10-16-26/h5-18,20,22-24,28,30H,19,21H2,1-4H3/t23-,24+,28+,30+/m1/s1 |
| InChIKey | JDOBPXDOHQANCW-LASNWIGQSA-N |
| XLogP | 4.83 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|