C26H27NO5 — CID 53381016
[(3S,4S,5E)-4-[(4S)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]-2-methylhepta-1,5-dien-3-yl] benzoate (PubChem CID 53381016) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is [(3S,4S,5E)-4-[(4S)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]-2-methylhepta-1,5-dien-3-yl] benzoate.
| Compound Name | [(3S,4S,5E)-4-[(4S)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]-2-methylhepta-1,5-dien-3-yl] benzoate |
|---|---|
| PubChem CID | 53381016 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | [(3S,4S,5E)-4-[(4S)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]-2-methylhepta-1,5-dien-3-yl] benzoate |
| SMILES | C=C(C)[C@@H](OC(=O)c1ccccc1)[C@H](/C=C/C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C26H27NO5/c1-4-11-22(23(18(2)3)32-25(29)20-14-9-6-10-15-20)24(28)27-21(17-31-26(27)30)16-19-12-7-5-8-13-19/h4-15,21-23H,2,16-17H2,1,3H3/b11-4+/t21-,22-,23+/m0/s1 |
| InChIKey | PAJYDVVKTQEAGH-KUKUOEMSSA-N |
| XLogP | 4.57 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|