C33H47NO6Si — CID 57160292
ditert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(oxiran-2-yl)pyrrolidine-1,2-dicarboxylate (PubChem CID 57160292) has the molecular formula C33H47NO6Si and a molecular weight of 581.83 g/mol. Its IUPAC name is ditert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(oxiran-2-yl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(oxiran-2-yl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 57160292 |
| Molecular Formula | C33H47NO6Si |
| Molecular Weight | 581.83 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | ditert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(oxiran-2-yl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C2CO2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H47NO6Si/c1-31(2,3)39-29(35)26-20-23(28(27-22-37-27)34(26)30(36)40-32(4,5)6)21-38-41(33(7,8)9,24-16-12-10-13-17-24)25-18-14-11-15-19-25/h10-19,23,26-28H,20-22H2,1-9H3/t23-,26?,27?,28+/m0/s1 |
| InChIKey | SCOHXGKIZFXEGW-QTLMMWTESA-N |
| XLogP | 5.30 |
| TPSA | 77.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.83 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|