C30H45NO3Si — CID 54275258
tert-butyl 1-butyl-4-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidine-2-carboxylate (PubChem CID 54275258) has the molecular formula C30H45NO3Si and a molecular weight of 495.78 g/mol. Its IUPAC name is tert-butyl 1-butyl-4-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl 1-butyl-4-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 54275258 |
| Molecular Formula | C30H45NO3Si |
| Molecular Weight | 495.78 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | tert-butyl 1-butyl-4-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCN1CC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H45NO3Si/c1-8-9-20-31-22-24(21-27(31)28(32)34-29(2,3)4)23-33-35(30(5,6)7,25-16-12-10-13-17-25)26-18-14-11-15-19-26/h10-19,24,27H,8-9,20-23H2,1-7H3 |
| InChIKey | RMYNAXYCVYFBQN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.78 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|