C28H41NO3Si — CID 57066288
tert-butyl 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-ethylpyrrolidine-2-carboxylate (PubChem CID 57066288) has the molecular formula C28H41NO3Si and a molecular weight of 467.73 g/mol. Its IUPAC name is tert-butyl 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-ethylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-ethylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57066288 |
| Molecular Formula | C28H41NO3Si |
| Molecular Weight | 467.73 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | tert-butyl 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-ethylpyrrolidine-2-carboxylate |
| SMILES | CCN1CC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H41NO3Si/c1-8-29-20-22(19-25(29)26(30)32-27(2,3)4)21-31-33(28(5,6)7,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,22,25H,8,19-21H2,1-7H3 |
| InChIKey | WQSVERLUQZIWKN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.73 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|