C29H41NO3Si — CID 57409149
methyl (2S)-1-[(E)-6-[tert-butyl(diphenyl)silyl]oxy-2-methylhex-2-enyl]pyrrolidine-2-carboxylate (PubChem CID 57409149) has the molecular formula C29H41NO3Si and a molecular weight of 479.74 g/mol. Its IUPAC name is methyl (2S)-1-[(E)-6-[tert-butyl(diphenyl)silyl]oxy-2-methylhex-2-enyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(E)-6-[tert-butyl(diphenyl)silyl]oxy-2-methylhex-2-enyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57409149 |
| Molecular Formula | C29H41NO3Si |
| Molecular Weight | 479.74 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | methyl (2S)-1-[(E)-6-[tert-butyl(diphenyl)silyl]oxy-2-methylhex-2-enyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C/C(C)=C/CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H41NO3Si/c1-24(23-30-21-14-20-27(30)28(31)32-5)15-12-13-22-33-34(29(2,3)4,25-16-8-6-9-17-25)26-18-10-7-11-19-26/h6-11,15-19,27H,12-14,20-23H2,1-5H3/b24-15+/t27-/m0/s1 |
| InChIKey | AICFGMRAWUMKTR-LMVGNEGFSA-N |
| XLogP | 4.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.74 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|