C23H29NO4Si — CID 15483164
methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-oxopyrrolidine-1-carboxylate (PubChem CID 15483164) has the molecular formula C23H29NO4Si and a molecular weight of 411.57 g/mol. Its IUPAC name is methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-oxopyrrolidine-1-carboxylate.
| Compound Name | methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15483164 |
| Molecular Formula | C23H29NO4Si |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-oxopyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1C(=O)CC[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H29NO4Si/c1-23(2,3)29(19-11-7-5-8-12-19,20-13-9-6-10-14-20)28-17-18-15-16-21(25)24(18)22(26)27-4/h5-14,18H,15-17H2,1-4H3/t18-/m0/s1 |
| InChIKey | PJQXSEMPRNLESV-SFHVURJKSA-N |
| XLogP | 3.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|