C24H29NO3Si — CID 11668645
1-[(2R)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]pyrrolidine-2,5-dione (PubChem CID 11668645) has the molecular formula C24H29NO3Si and a molecular weight of 407.59 g/mol. Its IUPAC name is 1-[(2R)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(2R)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11668645 |
| Molecular Formula | C24H29NO3Si |
| Molecular Weight | 407.59 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 1-[(2R)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]pyrrolidine-2,5-dione |
| SMILES | C=C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N1C(=O)CCC1=O |
| InChI | InChI=1S/C24H29NO3Si/c1-5-19(25-22(26)16-17-23(25)27)18-28-29(24(2,3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h5-15,19H,1,16-18H2,2-4H3/t19-/m1/s1 |
| InChIKey | CNZOPNIODKURRV-LJQANCHMSA-N |
| XLogP | 3.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|