C29H35NO3Si — CID 57385728
methyl (2S,3S)-1-benzyl-3-[tert-butyl(diphenyl)silyl]oxypyrrolidine-2-carboxylate (PubChem CID 57385728) has the molecular formula C29H35NO3Si and a molecular weight of 473.69 g/mol. Its IUPAC name is methyl (2S,3S)-1-benzyl-3-[tert-butyl(diphenyl)silyl]oxypyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3S)-1-benzyl-3-[tert-butyl(diphenyl)silyl]oxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57385728 |
| Molecular Formula | C29H35NO3Si |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | methyl (2S,3S)-1-benzyl-3-[tert-butyl(diphenyl)silyl]oxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C29H35NO3Si/c1-29(2,3)34(24-16-10-6-11-17-24,25-18-12-7-13-19-25)33-26-20-21-30(27(26)28(31)32-4)22-23-14-8-5-9-15-23/h5-19,26-27H,20-22H2,1-4H3/t26-,27-/m0/s1 |
| InChIKey | BIVKOKOAUQDLJW-SVBPBHIXSA-N |
| XLogP | 4.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|