C20H23NO2 — CID 102263792
methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate (PubChem CID 102263792) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102263792 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO2/c1-23-20(22)18-13-8-14-21(18)19(17-11-6-3-7-12-17)15-16-9-4-2-5-10-16/h2-7,9-12,18-19H,8,13-15H2,1H3/t18-,19?/m0/s1 |
| InChIKey | RSDOLZBRUONABU-OYKVQYDMSA-N |
| XLogP | 3.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |