methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate

C20H23NO2 — CID 102263792

IUPACmethyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate
SMILESCOC(=O)[C@@H]1CCCN1C(Cc1ccccc1)c1ccccc1
InChIInChI=1S/C20H23NO2/c1-23-20(22)18-13-8-14-21(18)19(17-11-6-3-7-12-17)15-16-9-4-2-5-10-16/h2-7,9-12,18-19H,8,13-15H2,1H3/t18-,19?/m0/s1
InChIKeyRSDOLZBRUONABU-OYKVQYDMSA-N
MW309.41 g/mol
LogP3.61
Rot. Bonds5

About methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate

methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate (PubChem CID 102263792) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate.

Molecular Properties

Compound Namemethyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate
PubChem CID102263792
Molecular FormulaC20H23NO2
Molecular Weight309.41 g/mol
Exact Mass309.17
IUPAC Namemethyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate
SMILESCOC(=O)[C@@H]1CCCN1C(Cc1ccccc1)c1ccccc1
InChIInChI=1S/C20H23NO2/c1-23-20(22)18-13-8-14-21(18)19(17-11-6-3-7-12-17)15-16-9-4-2-5-10-16/h2-7,9-12,18-19H,8,13-15H2,1H3/t18-,19?/m0/s1
InChIKeyRSDOLZBRUONABU-OYKVQYDMSA-N
XLogP3.61
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.41
LogP ≤ 53.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate?
The IUPAC name of methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate (CID 102263792) is methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate.
What is the SMILES notation for methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate?
The canonical SMILES for methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate is COC(=O)[C@@H]1CCCN1C(Cc1ccccc1)c1ccccc1.
What is the InChIKey of methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate?
The InChIKey is RSDOLZBRUONABU-OYKVQYDMSA-N. The full InChI is InChI=1S/C20H23NO2/c1-23-20(22)18-13-8-14-21(18)19(17-11-6-3-7-12-17)15-16-9-4-2-5-10-16/h2-7,9-12,18-19H,8,13-15H2,1H3/t18-,19?/m0/s1.
What are the key properties of methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate?
methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate has a molecular weight of 309.41 g/mol, XLogP of 3.61, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-1-(1,2-diphenylethyl)pyrrolidine-2-carboxylate is sourced from PubChem (CID 102263792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).