C28H27NO3 — CID 134940231
methyl (2S)-4-prop-2-ynoxy-1-tritylpyrrolidine-2-carboxylate (PubChem CID 134940231) has the molecular formula C28H27NO3 and a molecular weight of 425.53 g/mol. Its IUPAC name is methyl (2S)-4-prop-2-ynoxy-1-tritylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-4-prop-2-ynoxy-1-tritylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 134940231 |
| Molecular Formula | C28H27NO3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | methyl (2S)-4-prop-2-ynoxy-1-tritylpyrrolidine-2-carboxylate |
| SMILES | C#CCOC1C[C@@H](C(=O)OC)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C28H27NO3/c1-3-19-32-25-20-26(27(30)31-2)29(21-25)28(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h1,4-18,25-26H,19-21H2,2H3/t25?,26-/m0/s1 |
| InChIKey | MKMQVYHBTYPZPF-AMVUTOCUSA-N |
| XLogP | 4.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|