C25H24FNO2 — CID 135012665
methyl (2S,4S)-4-fluoro-1-tritylpyrrolidine-2-carboxylate (PubChem CID 135012665) has the molecular formula C25H24FNO2 and a molecular weight of 389.47 g/mol. Its IUPAC name is methyl (2S,4S)-4-fluoro-1-tritylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-4-fluoro-1-tritylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 135012665 |
| Molecular Formula | C25H24FNO2 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | methyl (2S,4S)-4-fluoro-1-tritylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](F)CN1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H24FNO2/c1-29-24(28)23-17-22(26)18-27(23)25(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,22-23H,17-18H2,1H3/t22-,23-/m0/s1 |
| InChIKey | RPZXWANCLLJYBI-GOTSBHOMSA-N |
| XLogP | 4.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|