C25H45NO4Si2 — CID 139216925
methyl (2S,3S,4S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidine-2-carboxylate (PubChem CID 139216925) has the molecular formula C25H45NO4Si2 and a molecular weight of 479.81 g/mol. Its IUPAC name is methyl (2S,3S,4S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3S,4S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 139216925 |
| Molecular Formula | C25H45NO4Si2 |
| Molecular Weight | 479.81 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | methyl (2S,3S,4S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)CN1Cc1ccccc1 |
| InChI | InChI=1S/C25H45NO4Si2/c1-24(2,3)31(8,9)29-20-18-26(17-19-15-13-12-14-16-19)21(23(27)28-7)22(20)30-32(10,11)25(4,5)6/h12-16,20-22H,17-18H2,1-11H3/t20-,21-,22+/m0/s1 |
| InChIKey | ABXOOFRTXFEXFP-FDFHNCONSA-N |
| XLogP | 5.82 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.81 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|