C25H43NO5Si2 — CID 139216927
methyl (2R,3S,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopyrrolidine-2-carboxylate (PubChem CID 139216927) has the molecular formula C25H43NO5Si2 and a molecular weight of 493.79 g/mol. Its IUPAC name is methyl (2R,3S,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,3S,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 139216927 |
| Molecular Formula | C25H43NO5Si2 |
| Molecular Weight | 493.79 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | methyl (2R,3S,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H43NO5Si2/c1-24(2,3)32(8,9)30-20-19(23(28)29-7)26(17-18-15-13-12-14-16-18)22(27)21(20)31-33(10,11)25(4,5)6/h12-16,19-21H,17H2,1-11H3/t19-,20+,21-/m1/s1 |
| InChIKey | ANUNTXYQQUVNMY-QHAWAJNXSA-N |
| XLogP | 5.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.79 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|