C25H43NO5Si2 — CID 10435813
[(3R,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopyrrolidin-2-yl] acetate (PubChem CID 10435813) has the molecular formula C25H43NO5Si2 and a molecular weight of 493.79 g/mol. Its IUPAC name is [(3R,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopyrrolidin-2-yl] acetate.
| Compound Name | [(3R,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopyrrolidin-2-yl] acetate |
|---|---|
| PubChem CID | 10435813 |
| Molecular Formula | C25H43NO5Si2 |
| Molecular Weight | 493.79 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | [(3R,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopyrrolidin-2-yl] acetate |
| SMILES | CC(=O)OC1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H43NO5Si2/c1-18(27)29-23-21(31-33(10,11)25(5,6)7)20(30-32(8,9)24(2,3)4)22(28)26(23)17-19-15-13-12-14-16-19/h12-16,20-21,23H,17H2,1-11H3/t20-,21-,23?/m1/s1 |
| InChIKey | XNRMIALYAVLKAK-OJOWTSHBSA-N |
| XLogP | 5.70 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.79 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|