C15H17NO6 — CID 14976991
[(3R,4S)-4-acetyloxy-1-benzyl-2-hydroxy-5-oxopyrrolidin-3-yl] acetate (PubChem CID 14976991) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is [(3R,4S)-4-acetyloxy-1-benzyl-2-hydroxy-5-oxopyrrolidin-3-yl] acetate.
| Compound Name | [(3R,4S)-4-acetyloxy-1-benzyl-2-hydroxy-5-oxopyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 14976991 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | [(3R,4S)-4-acetyloxy-1-benzyl-2-hydroxy-5-oxopyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=O)N(Cc2ccccc2)C(O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H17NO6/c1-9(17)21-12-13(22-10(2)18)15(20)16(14(12)19)8-11-6-4-3-5-7-11/h3-7,12-14,19H,8H2,1-2H3/t12-,13+,14?/m1/s1 |
| InChIKey | WVWIKWDVMZNYNW-AMIUJLCOSA-N |
| XLogP | 0.21 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |