C23H41NO4Si2 — CID 10095360
(3R,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxypyrrolidin-2-one (PubChem CID 10095360) has the molecular formula C23H41NO4Si2 and a molecular weight of 451.76 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxypyrrolidin-2-one.
| Compound Name | (3R,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 10095360 |
| Molecular Formula | C23H41NO4Si2 |
| Molecular Weight | 451.76 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | (3R,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxypyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C(=O)N(Cc2ccccc2)C(O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H41NO4Si2/c1-22(2,3)29(7,8)27-18-19(28-30(9,10)23(4,5)6)21(26)24(20(18)25)16-17-14-12-11-13-15-17/h11-15,18-20,25H,16H2,1-10H3/t18-,19-,20?/m1/s1 |
| InChIKey | STHJSAJJCWGIHE-LEAGNCFPSA-N |
| XLogP | 5.13 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.76 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|