C17H21NO3 — CID 11748186
(3S,4S)-1-benzyl-3-buta-2,3-dienyl-5-ethoxy-4-hydroxypyrrolidin-2-one (PubChem CID 11748186) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-3-buta-2,3-dienyl-5-ethoxy-4-hydroxypyrrolidin-2-one.
| Compound Name | (3S,4S)-1-benzyl-3-buta-2,3-dienyl-5-ethoxy-4-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 11748186 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (3S,4S)-1-benzyl-3-buta-2,3-dienyl-5-ethoxy-4-hydroxypyrrolidin-2-one |
| SMILES | C=C=CC[C@@H]1C(=O)N(Cc2ccccc2)C(OCC)[C@H]1O |
| InChI | InChI=1S/C17H21NO3/c1-3-5-11-14-15(19)17(21-4-2)18(16(14)20)12-13-9-7-6-8-10-13/h5-10,14-15,17,19H,1,4,11-12H2,2H3/t14-,15-,17?/m0/s1 |
| InChIKey | RTLLIDVTIJJQJX-GIIGEWEBSA-N |
| XLogP | 2.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |