C26H45NO4Si2 — CID 11762719
(2S,3S)-3-[(2R)-1-benzyl-5-oxopyrrolidin-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxypropanal (PubChem CID 11762719) has the molecular formula C26H45NO4Si2 and a molecular weight of 491.82 g/mol. Its IUPAC name is (2S,3S)-3-[(2R)-1-benzyl-5-oxopyrrolidin-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxypropanal.
| Compound Name | (2S,3S)-3-[(2R)-1-benzyl-5-oxopyrrolidin-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxypropanal |
|---|---|
| PubChem CID | 11762719 |
| Molecular Formula | C26H45NO4Si2 |
| Molecular Weight | 491.82 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | (2S,3S)-3-[(2R)-1-benzyl-5-oxopyrrolidin-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxypropanal |
| SMILES | CC[Si](CC)(CC)O[C@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H45NO4Si2/c1-9-33(10-2,11-3)30-23(20-28)25(31-32(7,8)26(4,5)6)22-17-18-24(29)27(22)19-21-15-13-12-14-16-21/h12-16,20,22-23,25H,9-11,17-19H2,1-8H3/t22-,23-,25+/m1/s1 |
| InChIKey | RUNZBFXGQUJMFP-OYRHQHFDSA-N |
| XLogP | 6.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.82 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|