C31H45NO3Si2 — CID 101021871
(3R,4S,5S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2-phenylethynyl)pyrrolidin-2-one (PubChem CID 101021871) has the molecular formula C31H45NO3Si2 and a molecular weight of 535.88 g/mol. Its IUPAC name is (3R,4S,5S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2-phenylethynyl)pyrrolidin-2-one.
| Compound Name | (3R,4S,5S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2-phenylethynyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 101021871 |
| Molecular Formula | C31H45NO3Si2 |
| Molecular Weight | 535.88 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | (3R,4S,5S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2-phenylethynyl)pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N(Cc2ccccc2)[C@H]1C#Cc1ccccc1 |
| InChI | InChI=1S/C31H45NO3Si2/c1-30(2,3)36(7,8)34-27-26(22-21-24-17-13-11-14-18-24)32(23-25-19-15-12-16-20-25)29(33)28(27)35-37(9,10)31(4,5)6/h11-20,26-28H,23H2,1-10H3/t26-,27-,28+/m0/s1 |
| InChIKey | LHGIYCRTIRQFPZ-HZFUHODCSA-N |
| XLogP | 7.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.88 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|