C37H65NO4Si3 — CID 134863631
(2S,3S,4S)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(dibenzylamino)pentanal (PubChem CID 134863631) has the molecular formula C37H65NO4Si3 and a molecular weight of 672.19 g/mol. Its IUPAC name is (2S,3S,4S)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(dibenzylamino)pentanal.
| Compound Name | (2S,3S,4S)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(dibenzylamino)pentanal |
|---|---|
| PubChem CID | 134863631 |
| Molecular Formula | C37H65NO4Si3 |
| Molecular Weight | 672.19 g/mol |
| Exact Mass | 671.42 |
| IUPAC Name | (2S,3S,4S)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(dibenzylamino)pentanal |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=O)O[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C37H65NO4Si3/c1-35(2,3)43(10,11)40-29-32(38(26-30-22-18-16-19-23-30)27-31-24-20-17-21-25-31)34(42-45(14,15)37(7,8)9)33(28-39)41-44(12,13)36(4,5)6/h16-25,28,32-34H,26-27,29H2,1-15H3/t32-,33+,34-/m0/s1 |
| InChIKey | VBYNPHPGOGIOOJ-GMTSZFNJSA-N |
| XLogP | 10.06 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.19 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|