C24H43NO4Si2 — CID 10367249
(3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 10367249) has the molecular formula C24H43NO4Si2 and a molecular weight of 465.78 g/mol. Its IUPAC name is (3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 10367249 |
| Molecular Formula | C24H43NO4Si2 |
| Molecular Weight | 465.78 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | (3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](CO)N(Cc2ccccc2)C(=O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H43NO4Si2/c1-23(2,3)30(7,8)28-20-19(17-26)25(16-18-14-12-11-13-15-18)22(27)21(20)29-31(9,10)24(4,5)6/h11-15,19-21,26H,16-17H2,1-10H3/t19-,20+,21-/m1/s1 |
| InChIKey | NAXSMUCLEGDSNT-QHAWAJNXSA-N |
| XLogP | 5.17 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.78 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|