C19H29NO3Si — CID 11068016
(2S)-2-[(2R)-1-benzyl-5-oxopyrrolidin-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetaldehyde (PubChem CID 11068016) has the molecular formula C19H29NO3Si and a molecular weight of 347.53 g/mol. Its IUPAC name is (2S)-2-[(2R)-1-benzyl-5-oxopyrrolidin-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetaldehyde.
| Compound Name | (2S)-2-[(2R)-1-benzyl-5-oxopyrrolidin-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetaldehyde |
|---|---|
| PubChem CID | 11068016 |
| Molecular Formula | C19H29NO3Si |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (2S)-2-[(2R)-1-benzyl-5-oxopyrrolidin-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C=O)[C@H]1CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H29NO3Si/c1-19(2,3)24(4,5)23-17(14-21)16-11-12-18(22)20(16)13-15-9-7-6-8-10-15/h6-10,14,16-17H,11-13H2,1-5H3/t16-,17-/m1/s1 |
| InChIKey | UKKCACZJFCCEAR-IAGOWNOFSA-N |
| XLogP | 3.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|